694-71-3 Usage
Description
Bicyclo[2,2,1]hepten-7-one, also known as 7-norbornenone, is a bicyclic ketone compound with a unique seven-membered ring structure. It is characterized by the presence of two carbon-carbon double bonds and a ketone functional group, which makes it a versatile building block in organic synthesis.
Uses
Used in Pharmaceutical Industry:
Bicyclo[2,2,1]hepten-7-one is used as a reagent for the preparation of various bis-imidazoles, which are employed as hepatitis C virus inhibitors. Its unique structure allows for the formation of these bioactive compounds, which can help in the development of new antiviral drugs.
Used in Organic Synthesis:
Bicyclo[2,2,1]hepten-7-one is used as a key intermediate in the synthesis of complex organic molecules, such as (-)-curcumanolide A. Its presence in the molecule allows for the formation of multiple functional groups and structural motifs, making it a valuable building block in the synthesis of natural products and other bioactive compounds.
Check Digit Verification of cas no
The CAS Registry Mumber 694-71-3 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 6,9 and 4 respectively; the second part has 2 digits, 7 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 694-71:
(5*6)+(4*9)+(3*4)+(2*7)+(1*1)=93
93 % 10 = 3
So 694-71-3 is a valid CAS Registry Number.
InChI:InChI=1/C7H8O/c8-7-5-1-2-6(7)4-3-5/h1-2,5-6H,3-4H2