69503-94-2 Usage
Description
3,4,6-Tri-O-acetyl-2-deoxy-D-glucopyranose is a complex carbohydrate derivative that belongs to the class of sugars known as deoxy sugars. It is characterized by the presence of three acetyl groups attached to the 3, 4, and 6 positions of the glucopyranose ring, which is a type of sugar molecule. 3,4,6-TRI-O-ACETYL-2-DEOXY-D-GLUCOPYRANOSE is significant in the field of organic chemistry and pharmaceutical research due to its potential applications in the synthesis of various biologically active compounds.
Uses
Used in Pharmaceutical Industry:
3,4,6-Tri-O-acetyl-2-deoxy-D-glucopyranose is used as a reactant in the synthesis of Rebeccamycin (R140000) analogs with uncommon sugars. These analogs have demonstrated topoisomerase inhibition and antitumor activities, making them valuable in the development of novel cancer therapeutics. 3,4,6-TRI-O-ACETYL-2-DEOXY-D-GLUCOPYRANOSE's unique structure allows for the creation of new molecules with potential applications in cancer treatment, contributing to the advancement of pharmaceutical research and drug development.
Check Digit Verification of cas no
The CAS Registry Mumber 69503-94-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,9,5,0 and 3 respectively; the second part has 2 digits, 9 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 69503-94:
(7*6)+(6*9)+(5*5)+(4*0)+(3*3)+(2*9)+(1*4)=152
152 % 10 = 2
So 69503-94-2 is a valid CAS Registry Number.
InChI:InChI=1/C12H18O8/c1-6(13)17-5-10-12(19-8(3)15)9(18-7(2)14)4-11(16)20-10/h9-12,16H,4-5H2,1-3H3/t9-,10-,11u,12+/m1/s1
