6974-25-0 Usage
Description
2,4-Diamino-5,6,7,8-tetrahydro-6-quinazolinecarboxylic Acid is a chemical compound belonging to the class of substituted 6-substituted 5,6,7,8-tetrahydroquinazolines. It is characterized by its unique molecular structure, which features two amino groups at the 2nd and 4th positions, and a carboxylic acid group at the 6th position. 2,4-DiaMino-5,6,7,8-tetrahydro-6-quinazolinecarboxylic Acid is of significant interest due to its potential applications in various fields, particularly in the development of anticancer agents.
Uses
Used in Pharmaceutical Industry:
2,4-Diamino-5,6,7,8-tetrahydro-6-quinazolinecarboxylic Acid is used as a key intermediate for the synthesis of potential anticancer agents. Its unique molecular structure allows for the development of novel compounds with enhanced antitumor properties, making it a valuable asset in the fight against cancer.
Used in Anticancer Drug Development:
2,4-Diamino-5,6,7,8-tetrahydro-6-quinazolinecarboxylic Acid is employed as a building block in the design and synthesis of new anticancer drugs. Its incorporation into various drug candidates can potentially improve their efficacy, selectivity, and safety profile, leading to more effective treatments for cancer patients.
Used in Research and Development:
In addition to its applications in the pharmaceutical industry, 2,4-Diamino-5,6,7,8-tetrahydro-6-quinazolinecarboxylic Acid is also used in research and development settings. Scientists and researchers utilize this compound to study its chemical properties, reactivity, and potential interactions with biological targets, which can provide valuable insights into the development of new therapeutic strategies against cancer.
Check Digit Verification of cas no
The CAS Registry Mumber 6974-25-0 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 6,9,7 and 4 respectively; the second part has 2 digits, 2 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 6974-25:
(6*6)+(5*9)+(4*7)+(3*4)+(2*2)+(1*5)=130
130 % 10 = 0
So 6974-25-0 is a valid CAS Registry Number.
InChI:InChI=1/C9H12N4O2/c10-7-5-3-4(8(14)15)1-2-6(5)12-9(11)13-7/h4H,1-3H2,(H,14,15)(H4,10,11,12,13)
