701298-97-7 Usage
General Description
3-Bromo-6,7,8,9-tetrahydro-5H-imidazo[1,2-a]azepine is a chemical compound with the molecular formula C8H10BrN3. It is a heterocyclic compound that contains both a bromine atom and a nitrogen atom. 3-Bromo-6,7,8,9-tetrahydro-5H-imidazo[1,2-a]azepine has potential applications in the field of medicinal chemistry and drug development, particularly in the synthesis of pharmaceuticals. The structure of 3-Bromo-6,7,8,9-tetrahydro-5H-imidazo[1,2-a]azepine makes it a promising candidate for further research and development in the pharmaceutical industry, particularly for the synthesis of new therapeutic agents. Its unique structure and properties make it an interesting target for chemical synthesis and biological evaluation.
Check Digit Verification of cas no
The CAS Registry Mumber 701298-97-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 7,0,1,2,9 and 8 respectively; the second part has 2 digits, 9 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 701298-97:
(8*7)+(7*0)+(6*1)+(5*2)+(4*9)+(3*8)+(2*9)+(1*7)=157
157 % 10 = 7
So 701298-97-7 is a valid CAS Registry Number.
InChI:InChI=1/C8H11BrN2/c9-7-6-10-8-4-2-1-3-5-11(7)8/h6H,1-5H2
701298-97-7Relevant articles and documents
IMIDAZOLE DERIVATIVE, PROCESS FOR PRODUCING THE SAME, AND USE
-
Page/Page column 66-67, (2010/02/13)
There is provided an imidazole derivative useful as a thrombosis treating agent, which is represented by the formula (I): wherein R represents an optionally substituted cyclic hydrocarbon group or an optionally substituted heterocyclic group, W represents