70275-54-6 Usage
Description
[2-(4-HYDROXY-PHENYL)-ETHYL]-CARBAMIC ACID ETHYL ESTER is a chemical compound with the molecular formula C11H13NO4. It is an ethyl ester of [2-(4-hydroxy-phenyl)-ethyl]-carbamic acid, and it is commonly used in the pharmaceutical industry as an intermediate in the production of various drugs. Its structure contains a carbamate group, which has been implicated in the inhibition of various enzymes and receptors. [2-(4-HYDROXY-PHENYL)-ETHYL]-CARBAMIC ACID ETHYL ESTER is also known for its potential use in the treatment of various diseases, including cancer, due to its ability to modulate cellular pathways. Additionally, [2-(4-HYDROXY-PHENYL)-ETHYL]-CARBAMIC ACID ETHYL ESTER may have other potential applications in the field of organic chemistry and biochemistry, making it a valuable and versatile chemical compound.
Used in Pharmaceutical Industry:
[2-(4-HYDROXY-PHENYL)-ETHYL]-CARBAMIC ACID ETHYL ESTER is used as an intermediate in the production of various drugs for its ability to modulate cellular pathways and inhibit various enzymes and receptors.
Used in Cancer Treatment:
[2-(4-HYDROXY-PHENYL)-ETHYL]-CARBAMIC ACID ETHYL ESTER is used as a potential therapeutic agent for the treatment of various diseases, including cancer, due to its ability to modulate cellular pathways and inhibit enzymes and receptors involved in cancer progression.
Used in Organic Chemistry and Biochemistry:
[2-(4-HYDROXY-PHENYL)-ETHYL]-CARBAMIC ACID ETHYL ESTER is used as a valuable and versatile chemical compound for its potential applications in the field of organic chemistry and biochemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 70275-54-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,0,2,7 and 5 respectively; the second part has 2 digits, 5 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 70275-54:
(7*7)+(6*0)+(5*2)+(4*7)+(3*5)+(2*5)+(1*4)=116
116 % 10 = 6
So 70275-54-6 is a valid CAS Registry Number.
InChI:InChI=1/C11H15NO3/c1-2-15-11(14)12-8-7-9-3-5-10(13)6-4-9/h3-6,13H,2,7-8H2,1H3,(H,12,14)
70275-54-6Relevant articles and documents
OPIOID RECEPTOR ANTAGONISTS
-
Page/Page column 16; 31, (2010/02/14)
A compound of the formula (I) wherein the variables X1, X2, B, D, R1 to R7.including R3', p, y, q, and z, are as defined or a pharmaceutically acceptable salt, solvate, enantiomer, racemate, diastereomer or mixtures thereof, useful for the treatment, prev