7064-40-6 Usage
Description
4,5-dimethylisoxazole is a chemical compound with the molecular formula C6H9NO. It is an organic compound derived from isoxazole, a five-membered heterocyclic ring containing one oxygen and one nitrogen atom. 4,5-dimethylisoxazole is characterized by the presence of two methyl groups attached to the isoxazole ring, which contributes to its unique chemical properties and reactivity.
Uses
Used in Pharmaceutical Industry:
4,5-dimethylisoxazole is used as a key intermediate in the synthesis of certain pharmaceutical drugs. Its structure and reactivity make it a versatile molecule for creating new chemical compounds with potential therapeutic properties. It has been identified as a building block in organic synthesis, facilitating the development of novel drugs with improved efficacy and safety profiles.
Used in Agrochemical Industry:
In the agrochemical industry, 4,5-dimethylisoxazole is utilized as a component in the development of various agrochemical products. Its unique chemical properties allow it to be incorporated into formulations that can enhance crop protection, pest control, and overall agricultural productivity.
Used in Organic Synthesis:
4,5-dimethylisoxazole is used as a building block in organic synthesis for creating a wide range of chemical compounds. Its reactivity and structural features make it an ideal candidate for the synthesis of complex organic molecules, which can be further explored for their potential applications in various fields, including pharmaceuticals, materials science, and specialty chemicals.
Used in Anti-inflammatory and Analgesic Studies:
4,5-dimethylisoxazole has exhibited biological activity in anti-inflammatory and analgesic studies. Its potential therapeutic properties make it a valuable compound for the development of new treatments for pain and inflammation-related conditions. Further research and development in this area could lead to the discovery of novel drugs with improved efficacy and reduced side effects.
Check Digit Verification of cas no
The CAS Registry Mumber 7064-40-6 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 7,0,6 and 4 respectively; the second part has 2 digits, 4 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 7064-40:
(6*7)+(5*0)+(4*6)+(3*4)+(2*4)+(1*0)=86
86 % 10 = 6
So 7064-40-6 is a valid CAS Registry Number.
InChI:InChI=1/C30H42N4O4S2/c1-6-10-11-21(8-3)19-34-28(36)25(40-30(34)39)17-23-20(5)24(18-31)27(35)33(14-7-2)26(23)32-15-12-22(13-16-32)29(37)38-9-4/h17,21-22H,6-16,19H2,1-5H3