70682-64-3 Usage
Description
4-(4-cyclohexylphenoxy)aniline is an aniline derivative with a molecular formula of C18H21NO. It features a cyclohexyl group and a phenoxy group attached to the amino group, making it a versatile chemical compound.
Uses
Used in Pharmaceutical and Agrochemical Industries:
4-(4-cyclohexylphenoxy)aniline is used as a key intermediate in the synthesis of various pharmaceuticals and agrochemicals. Its unique structure allows for the development of new compounds with potential therapeutic and pesticidal properties.
Used in Dye and Pigment Production:
4-(4-cyclohexylphenoxy)aniline is also utilized in the production of dyes and pigments due to its ability to impart color. Its presence in these products contributes to the vibrancy and stability of the colors in various applications.
Used in Organic Compound Synthesis:
4-(4-cyclohexylphenoxy)aniline serves as an intermediate in the synthesis of a range of organic compounds. Its functional groups enable it to participate in various chemical reactions, facilitating the creation of diverse chemical products.
Safety Considerations:
Due to potential health hazards associated with 4-(4-cyclohexylphenoxy)aniline, it is crucial to handle this compound with care. Adherence to proper safety protocols and guidelines is essential to minimize risks during its production, use, and disposal.
Check Digit Verification of cas no
The CAS Registry Mumber 70682-64-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,0,6,8 and 2 respectively; the second part has 2 digits, 6 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 70682-64:
(7*7)+(6*0)+(5*6)+(4*8)+(3*2)+(2*6)+(1*4)=133
133 % 10 = 3
So 70682-64-3 is a valid CAS Registry Number.
InChI:InChI=1/C18H21NO/c19-16-8-12-18(13-9-16)20-17-10-6-15(7-11-17)14-4-2-1-3-5-14/h6-14H,1-5,19H2
