71901-21-8 Usage
General Description
N-FORMYL-NLE-LEU-PHE-NLE-TYR-LYS or Formyl-norleucyl-leucyl-phenylalanyl-norleucyl-tyrosyl-lysine is a complex chemical compound that consists of several different amino acids. These include norleucine (NLE), leucine (LEU), phenylalanine (PHE), tyrosine (TYR), and lysine (LYS). The compound is constructed in a specific sequence, which could have implications for its functional role in various biological systems. However, the exact nature and roles of this compound are not completely known, requiring further studies on its biological actions and potential applications in the context of biochemistry, pharmacology, and related fields. N-FORMYL-NLE-LEU-PHE-NLE-TYR-LYS may potentially be used in the processes of signaling and regulation within the cellular and molecular environment. This type of nonapeptide could hold the key to understanding various molecular interactions and functions at a deeper level.
Check Digit Verification of cas no
The CAS Registry Mumber 71901-21-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,1,9,0 and 1 respectively; the second part has 2 digits, 2 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 71901-21:
(7*7)+(6*1)+(5*9)+(4*0)+(3*1)+(2*2)+(1*1)=108
108 % 10 = 8
So 71901-21-8 is a valid CAS Registry Number.
InChI:InChI=1/C43H65N7O9/c1-5-7-16-32(45-27-51)38(53)48-35(24-28(3)4)40(55)50-36(25-29-14-10-9-11-15-29)41(56)46-33(17-8-6-2)39(54)49-37(26-30-19-21-31(52)22-20-30)42(57)47-34(43(58)59)18-12-13-23-44/h9-11,14-15,19-22,27-28,32-37,52H,5-8,12-13,16-18,23-26,44H2,1-4H3,(H,45,51)(H,46,56)(H,47,57)(H,48,53)(H,49,54)(H,50,55)(H,58,59)/t32-,33-,34-,35-,36-,37-/m0/s1