71965-10-1 Usage
Description
[(2,3,4-trichlorophenyl)thio]acetic acid, with the molecular formula C8H5Cl3O2S, is a sulfur-containing chemical compound featuring a trichlorophenyl group attached to the thioacetic acid molecule. [(2,3,4-trichlorophenyl)thio]acetic acid is known for its potential applications in various industries, including agriculture and pharmaceuticals, and is utilized in the synthesis of other organic compounds.
Uses
Used in Organic Synthesis:
[(2,3,4-trichlorophenyl)thio]acetic acid is used as a synthetic building block for the creation of other organic compounds. Its unique structure allows for the development of a wide range of chemical products, making it a valuable asset in the field of organic chemistry.
Used in Pharmaceutical Applications:
In the pharmaceutical industry, [(2,3,4-trichlorophenyl)thio]acetic acid is used as a precursor for the development of new drugs. Its specific properties and reactivity contribute to the design and synthesis of novel pharmaceutical compounds, potentially leading to advancements in medical treatments.
Used in Agricultural Applications:
[(2,3,4-trichlorophenyl)thio]acetic acid may also find use in the agricultural sector, where it could be employed in the development of new pesticides or other agrochemicals. Its unique chemical structure offers potential for the creation of innovative products that can address various agricultural needs.
Safety Precautions:
It is crucial to handle [(2,3,4-trichlorophenyl)thio]acetic acid with care, as it may pose risks to human health and the environment if not properly managed. Appropriate safety measures should be taken during its production, use, and disposal to minimize potential hazards.
Check Digit Verification of cas no
The CAS Registry Mumber 71965-10-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,1,9,6 and 5 respectively; the second part has 2 digits, 1 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 71965-10:
(7*7)+(6*1)+(5*9)+(4*6)+(3*5)+(2*1)+(1*0)=141
141 % 10 = 1
So 71965-10-1 is a valid CAS Registry Number.
InChI:InChI=1/C8H5Cl3O2S/c9-4-1-2-5(8(11)7(4)10)14-3-6(12)13/h1-2H,3H2,(H,12,13)
