72087-40-2 Usage
General Description
L-Arginine mono(4-methyl-2-oxovalerate) is a chemical compound that consists of the amino acid L-Arginine bound to the organic compound 4-methyl-2-oxovalerate. L-Arginine is a semi-essential amino acid that plays a crucial role in protein synthesis, immune function, and the production of nitric oxide. It is commonly found in foods such as meat, fish, and dairy products. 4-methyl-2-oxovalerate, on the other hand, is a derivative of 2-oxovaleric acid, an organic acid involved in various metabolic pathways. L-Arginine mono(4-methyl-2-oxovalerate) is not as well-studied as L-Arginine, but it likely contributes to the overall properties and applications of L-Arginine mono(4-methyl-2-oxovalerate) in research and industrial settings.
Check Digit Verification of cas no
The CAS Registry Mumber 72087-40-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,2,0,8 and 7 respectively; the second part has 2 digits, 4 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 72087-40:
(7*7)+(6*2)+(5*0)+(4*8)+(3*7)+(2*4)+(1*0)=122
122 % 10 = 2
So 72087-40-2 is a valid CAS Registry Number.
InChI:InChI=1/C6H14N4O2.C6H10O3/c7-4(5(11)12)2-1-3-10-6(8)9;1-4(2)3-5(7)6(8)9/h4H,1-3,7H2,(H,11,12)(H4,8,9,10);4H,3H2,1-2H3,(H,8,9)
