72093-22-2 Usage
Description
MASTOPARAN X is a synthetic peptide that exhibits similar effects to mastoparan, a wasp venom component. It has the ability to bind with high affinity to calmodulin, a calcium-binding protein, and inhibit sarcoplasmic reticulum calcium-ATPase, which plays a crucial role in calcium ion transport and regulation.
Uses
Used in Pharmaceutical Industry:
MASTOPARAN X is used as a research tool for studying the interactions between calmodulin and other proteins, as well as the role of calcium-ATPase in calcium ion transport and regulation. Its high affinity binding to calmodulin makes it a valuable compound for investigating the molecular mechanisms underlying various cellular processes.
Used in Biochemical Research:
MASTOPARAN X is used as an inhibitor of sarcoplasmic reticulum calcium-ATPase for understanding the role of this enzyme in calcium ion transport and its implications in muscle contraction and other physiological processes. This can help researchers gain insights into the development of potential therapeutic agents targeting calcium-ATPase related disorders.
Used in Drug Discovery:
MASTOPARAN X can be employed as a lead compound in the development of new drugs targeting calmodulin-mediated signaling pathways and calcium-ATPase related diseases. Its unique properties and ability to modulate these pathways make it a promising candidate for the discovery of novel therapeutic agents.
Check Digit Verification of cas no
The CAS Registry Mumber 72093-22-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,2,0,9 and 3 respectively; the second part has 2 digits, 2 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 72093-22:
(7*7)+(6*2)+(5*0)+(4*9)+(3*3)+(2*2)+(1*2)=112
112 % 10 = 2
So 72093-22-2 is a valid CAS Registry Number.
InChI:InChI=1/C73H126N20O15S/c1-13-41(7)59(78)72(107)92-56(36-57(77)94)71(106)91-55(35-46-37-80-48-24-16-15-23-47(46)48)70(105)87-49(25-17-20-29-74)65(100)81-38-58(95)93-60(42(8)14-2)73(108)84-43(9)62(97)82-44(10)63(98)86-52(28-32-109-12)66(101)83-45(11)64(99)85-50(26-18-21-30-75)67(102)88-51(27-19-22-31-76)68(103)90-54(34-40(5)6)69(104)89-53(61(79)96)33-39(3)4/h15-16,23-24,37,39-45,49-56,59-60,80H,13-14,17-22,25-36,38,74-76,78H2,1-12H3,(H2,77,94)(H2,79,96)(H,81,100)(H,82,97)(H,83,101)(H,84,108)(H,85,99)(H,86,98)(H,87,105)(H,88,102)(H,89,104)(H,90,103)(H,91,106)(H,92,107)(H,93,95)/t41-,42-,43-,44-,45-,49-,50-,51-,52-,53-,54-,55-,56-,59-,60?/m0/s1