7229-15-4 Usage
Chemical structure
A heterocyclic compound containing a ring structure with three nitrogen atoms and two carbon atoms.
Functional groups
Contains a carboxamide group and a p-bromophenyl triazeno group.
Triazene group
Contains a nitrogen-nitrogen double bond attached to the p-bromophenyl group.
Potential applications
Chemical research, pharmaceuticals, and materials science.
Unique heterocyclic structure
The presence of the triazole ring and the triazene group contribute to its unique structure.
Potential reactivity
The compound's reactivity is not explicitly mentioned, but its unique structure suggests it may have interesting chemical properties.
Further research
More detailed studies on its properties and potential uses would provide further insight into its potential applications.
Please note that some information, such as the molecular formula, was inferred based on the provided material and general knowledge of chemical structures.
Check Digit Verification of cas no
The CAS Registry Mumber 7229-15-4 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 7,2,2 and 9 respectively; the second part has 2 digits, 1 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 7229-15:
(6*7)+(5*2)+(4*2)+(3*9)+(2*1)+(1*5)=94
94 % 10 = 4
So 7229-15-4 is a valid CAS Registry Number.
InChI:InChI=1/C9H8BrN7O/c10-5-1-3-6(4-2-5)12-16-14-9-7(8(11)18)13-17-15-9/h1-4,12,16H,(H2,11,18)
