7252-26-8 Usage
Explanation
The compound consists of 10 carbon atoms, 12 hydrogen atoms, and 4 oxygen atoms in its structure.
Explanation
1-oxo-3,4,4a,7,8,8a-hexahydroisochromene-5-carboxylic acid belongs to the gamma butyrolactone class of organic compounds, which are characterized by a four-membered lactone ring and a hydroxyl group.
3. Carboxylic acid derivative
Explanation
This compound contains a carboxyl group (-COOH) attached to the isochromene structure, making it a derivative of a carboxylic acid.
4. Coumarins and derivatives
Explanation
1-oxo-3,4,4a,7,8,8a-hexahydroisochromene-5-carboxylic acid is a member of the coumarins class of compounds, which are characterized by a benzopyrone structure and are known for their medicinal properties.
5. Synthesis of other organic compounds
Explanation
This compound is often used as a starting material or intermediate in the synthesis of other organic compounds due to its unique chemical properties.
6. Pharmaceutical applications
Explanation
The compound has potential pharmaceutical applications, as it may exhibit biological activity or serve as a building block for the development of new drugs.
Organic compound class
Gamma butyrolactones
Check Digit Verification of cas no
The CAS Registry Mumber 7252-26-8 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 7,2,5 and 2 respectively; the second part has 2 digits, 2 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 7252-26:
(6*7)+(5*2)+(4*5)+(3*2)+(2*2)+(1*6)=88
88 % 10 = 8
So 7252-26-8 is a valid CAS Registry Number.
InChI:InChI=1/C10H12O4/c11-9(12)7-2-1-3-8-6(7)4-5-14-10(8)13/h2,6,8H,1,3-5H2,(H,11,12)
