72846-00-5 Usage
Description
1-Phenylmethyl-5-phenyl-barbituric acid is an organic compound with the molecular formula C15H12N2O3. It is a derivative of barbituric acid, featuring a phenylmethyl group at the 1st position and a phenyl group at the 5th position. 1-Phenylmethyl-5-phenyl-barbituric acid is known for its potential applications in various fields due to its unique chemical structure and properties.
Uses
Used in Pharmaceutical Industry:
1-Phenylmethyl-5-phenyl-barbituric acid is used as a pharmaceutical intermediate in organic synthesis for the development of new drugs. Its unique structure allows it to serve as a key building block in the synthesis of various pharmaceutical compounds, contributing to the advancement of drug discovery and development.
Used in Chemical Research:
In addition to its pharmaceutical applications, 1-Phenylmethyl-5-phenyl-barbituric acid can also be utilized in chemical research for studying the properties and reactions of barbituric acid derivatives. This can lead to a better understanding of the chemical behavior of similar compounds and potentially uncover new applications or modifications for existing uses.
Check Digit Verification of cas no
The CAS Registry Mumber 72846-00-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,2,8,4 and 6 respectively; the second part has 2 digits, 0 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 72846-00:
(7*7)+(6*2)+(5*8)+(4*4)+(3*6)+(2*0)+(1*0)=135
135 % 10 = 5
So 72846-00-5 is a valid CAS Registry Number.
InChI:InChI=1/C17H14N2O3/c20-15-14(13-9-5-2-6-10-13)16(21)19(17(22)18-15)11-12-7-3-1-4-8-12/h1-10,14H,11H2,(H,18,20,22)