73086-97-2 Usage
Description
L-A-AMINOXY-B-PHENYLPROPIONIC ACID, HYDROBROMIDE is a white powder that serves as a useful intermediate for the synthesis of optically active amino acids. It is a chemical compound with significant applications in the pharmaceutical and chemical industries due to its unique properties and reactivity.
Uses
Used in Pharmaceutical Industry:
L-A-AMINOXY-B-PHENYLPROPIONIC ACID, HYDROBROMIDE is used as a key intermediate for the synthesis of optically active amino acids, which are essential building blocks for various pharmaceutical compounds. These amino acids play a crucial role in the development of drugs targeting specific biological processes and have potential applications in the treatment of various diseases and medical conditions.
Used in Chemical Industry:
In the chemical industry, L-A-AMINOXY-B-PHENYLPROPIONIC ACID, HYDROBROMIDE is utilized as a versatile intermediate for the production of various specialty chemicals and materials. Its unique chemical properties allow it to be used in the synthesis of complex molecules and compounds, contributing to the development of innovative products and technologies in the chemical sector.
Check Digit Verification of cas no
The CAS Registry Mumber 73086-97-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,3,0,8 and 6 respectively; the second part has 2 digits, 9 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 73086-97:
(7*7)+(6*3)+(5*0)+(4*8)+(3*6)+(2*9)+(1*7)=142
142 % 10 = 2
So 73086-97-2 is a valid CAS Registry Number.
InChI:InChI=1/C10H13NO3.BrH/c12-10(13)11-14-8-4-7-9-5-2-1-3-6-9;/h1-3,5-6,11H,4,7-8H2,(H,12,13);1H
