73117-10-9 Usage
Type of compound
Alkyne derivative
Functional groups
Diethylamino group, Pentynyl group
Uses
Organic synthesis reagent, preparation of biologically active compounds and pharmaceuticals, potential building block in synthesis of new materials, ligand in coordination chemistry
Hazards
Flammability, potential health hazards, hazardous chemical (should be handled with care)
Check Digit Verification of cas no
The CAS Registry Mumber 73117-10-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,3,1,1 and 7 respectively; the second part has 2 digits, 1 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 73117-10:
(7*7)+(6*3)+(5*1)+(4*1)+(3*7)+(2*1)+(1*0)=99
99 % 10 = 9
So 73117-10-9 is a valid CAS Registry Number.
InChI:InChI=1/C9H17N/c1-4-7-8-9-10(5-2)6-3/h4-6,9H2,1-3H3