73355-43-8 Usage
Description
(4,7-diacetyloxy-2-chloro-3-formyl-6-methyl-1H-indol-5-yl) acetate is an organic compound characterized by its complex molecular structure, which includes acetyl, chloro, formyl, methyl, and indolyl functional groups. This unique structure suggests potential pharmaceutical or industrial applications due to its reactivity and possible interactions with biological systems.
Uses
Used in Pharmaceutical Industry:
(4,7-diacetyloxy-2-chloro-3-formyl-6-methyl-1H-indol-5-yl) acetate is used as a chemical intermediate for the synthesis of various pharmaceutical compounds. Its diverse functional groups, such as acetyl and formyl, provide opportunities for further chemical reactions and modifications, potentially leading to the development of new drugs with specific therapeutic properties.
Used in Chemical Research:
In the field of chemical research, (4,7-diacetyloxy-2-chloro-3-formyl-6-methyl-1H-indol-5-yl) acetate serves as a valuable compound for studying its reactivity and understanding the effects of its functional groups on its overall properties. This knowledge can be applied to design and synthesize new molecules with tailored characteristics for specific applications.
Used in Material Science:
(4,7-diacetyloxy-2-chloro-3-formyl-6-methyl-1H-indol-5-yl) acetate may also find applications in material science, where its unique structure could be exploited to create novel materials with specific properties. For instance, its indolyl moiety might allow for interactions with other molecules, potentially leading to the development of new materials with enhanced properties such as improved stability or reactivity.
Further research and analysis are required to fully comprehend the properties and potential uses of (4,7-diacetyloxy-2-chloro-3-formyl-6-methyl-1H-indol-5-yl) acetate, as its complex structure and diverse functional groups offer a wide range of possibilities across various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 73355-43-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,3,3,5 and 5 respectively; the second part has 2 digits, 4 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 73355-43:
(7*7)+(6*3)+(5*3)+(4*5)+(3*5)+(2*4)+(1*3)=128
128 % 10 = 8
So 73355-43-8 is a valid CAS Registry Number.
InChI:InChI=1/C16H14ClNO7/c1-6-13(23-7(2)20)12-11(10(5-19)16(17)18-12)15(25-9(4)22)14(6)24-8(3)21/h5,18H,1-4H3