73850-50-7 Usage
General Description
2-carboxypropyl methacrylate is a chemical compound that is commonly used in the production of polymers and resins. It is a methacrylate derivative with a carboxylic acid functional group and a propyl side chain. This chemical is utilized in the synthesis of hydrogels, pressure-sensitive adhesives, and ion exchange resins. Its carboxylic acid group makes it suitable for use in bioconjugation reactions, and it is often incorporated into copolymers to introduce a functional group for further modification. Additionally, 2-carboxypropyl methacrylate can be used as a crosslinking agent in the formation of various polymer materials with applications in industries such as healthcare, automotive, and electronics.
Check Digit Verification of cas no
The CAS Registry Mumber 73850-50-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,3,8,5 and 0 respectively; the second part has 2 digits, 5 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 73850-50:
(7*7)+(6*3)+(5*8)+(4*5)+(3*0)+(2*5)+(1*0)=137
137 % 10 = 7
So 73850-50-7 is a valid CAS Registry Number.
InChI:InChI=1/C8H12O4/c1-5(2)8(11)12-4-6(3)7(9)10/h6H,1,4H2,2-3H3,(H,9,10)
