73863-46-4 Usage
Description
2-chloro-3,7-dimethylquinoline is an organic compound with the molecular formula C11H8ClN. It is characterized by the presence of a chlorine atom at the 2nd position, and methyl groups at the 3rd and 7th positions on a quinoline ring. 2-chloro-3,7-dimethylquinoline is known for its chemical reactivity and potential applications in various fields.
Uses
Used in Pharmaceutical Industry:
2-chloro-3,7-dimethylquinoline is used as a key intermediate in the synthesis of various pharmaceutical compounds. Its unique structure allows for the formation of new chemical entities with potential therapeutic properties.
Used in Chemical Synthesis:
2-chloro-3,7-dimethylquinoline is used as a reactant for the synthesis of 2-(1H-1,2,4-triazol-1-yl)quinolines. These triazole-containing quinoline derivatives exhibit a wide range of biological activities, making them valuable for the development of new drugs and agrochemicals.
Check Digit Verification of cas no
The CAS Registry Mumber 73863-46-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,3,8,6 and 3 respectively; the second part has 2 digits, 4 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 73863-46:
(7*7)+(6*3)+(5*8)+(4*6)+(3*3)+(2*4)+(1*6)=154
154 % 10 = 4
So 73863-46-4 is a valid CAS Registry Number.
InChI:InChI=1/C11H10ClN/c1-7-3-4-9-6-8(2)11(12)13-10(9)5-7/h3-6H,1-2H3
73863-46-4Relevant articles and documents
Red phosphorescent compounds and organic electromuninescent devices using the same
-
Page/Page column 26-27, (2008/06/13)
Disclosed herein are red phosphorescent compounds of the following Formulas 1 to 4: wherein is R1-R7 have the meaning as detailed in the application and is selected from 2,4-pentanedione, 2,2,6,6,-tetramethylheptane-3,5-dione, 1,3-pr
