7396-41-0 Usage
Description
1,3-DITHIOLE-2-THIONE-4,5-DICARBOXYLIC ACID DIMETHYL ESTER, also known as Dimethyl 2-thioxo-1,3-dithiole-4,5-dicarboxylate, is a sulfur-containing heterocyclic compound that serves as a valuable building block in the synthesis of various organic compounds. It is formed as a major product during the reaction of ethylene trithiocarbonate with dimethyl acetylenedicarboxylate and is known for its unique chemical properties and potential applications in different industries.
Uses
Used in Pharmaceutical Industry:
1,3-DITHIOLE-2-THIONE-4,5-DICARBOXYLIC ACID DIMETHYL ESTER is used as an intermediate compound for the synthesis of various pharmaceuticals. Its unique sulfur-containing heterocyclic structure makes it a promising candidate for the development of new drugs with potential therapeutic applications.
Used in Chemical Synthesis:
1,3-DITHIOLE-2-THIONE-4,5-DICARBOXYLIC ACID DIMETHYL ESTER is used as a key building block in the synthesis of a wide range of organic compounds, including dyes, pigments, and other specialty chemicals. Its versatile chemical properties allow for various functional group transformations and reactions, making it a valuable component in the chemical industry.
Used in Material Science:
1,3-DITHIOLE-2-THIONE-4,5-DICARBOXYLIC ACID DIMETHYL ESTER is used as a component in the development of novel materials with unique properties, such as conductive polymers and sensors. Its sulfur-containing heterocyclic structure can contribute to the electronic and optical properties of these materials, making it an important player in the field of material science.
Used in Research and Development:
1,3-DITHIOLE-2-THIONE-4,5-DICARBOXYLIC ACID DIMETHYL ESTER is used as a research compound for studying its chemical properties, reactivity, and potential applications in various fields. Its formation and reaction mechanisms can provide valuable insights into the development of new synthetic methods and the discovery of new compounds with diverse applications.
Synthesis Reference(s)
The Journal of Organic Chemistry, 47, p. 4000, 1982 DOI: 10.1021/jo00141a044
Check Digit Verification of cas no
The CAS Registry Mumber 7396-41-0 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 7,3,9 and 6 respectively; the second part has 2 digits, 4 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 7396-41:
(6*7)+(5*3)+(4*9)+(3*6)+(2*4)+(1*1)=120
120 % 10 = 0
So 7396-41-0 is a valid CAS Registry Number.
InChI:InChI=1/C7H6O4S3/c1-10-5(8)3-4(6(9)11-2)14-7(12)13-3/h1-2H3
7396-41-0Relevant articles and documents
A NEW CONVENIENT METHOD FOR THE SYNTHESIS OF 1,3-DITHIOLANE-2-THIONES AND THEIR USE FOR THE SYNTHESIS OF 4,5-DIMETHOXYCARBONYL-1,3-DITHIOLE-2-THIONE
Khodorkovskii, V.Yu.,Poikan, Ya.Ya.,Kreitsberga, Ya.N.,Neiland, O.Ya.
, p. 1224 - 1226 (2007/10/02)
A preparative method was developed for the synthesis of 1,3-dithiolane-2-thione and 4-phenyl-1,3-dithiolane-2-thione from dibromoethane and 1-phenyl-1,2-dibromoethane and potassium xanthates.It was shown that their reaction with dimethyl acetylenedicarboxylate without a solvent leads to 4,5-dimethoxycarbonyl-1,3-dithiole-2-thione with yields close to quantitative.
