74056-26-1 Usage
Description
2-[4-(1,2-diphenylvinyl)phenoxy]ethyl(diethyl)ammonium chloride is a complex organic compound characterized by its unique molecular structure, which features a quaternary ammonium group attached to a phenoxy-ethyl moiety. This structure endows it with specific chemical and physical properties that make it suitable for various applications.
Uses
Used in Pharmaceutical Industry:
2-[4-(1,2-diphenylvinyl)phenoxy]ethyl(diethyl)ammonium chloride is used as an active pharmaceutical ingredient for its estrogenic activity. It serves as an analog of Clomiphene, a compound with established uses in fertility treatments, and is particularly valuable in the development of antifertility agents.
Used in Chemical Research:
In the field of chemical research, 2-[4-(1,2-diphenylvinyl)phenoxy]ethyl(diethyl)ammonium chloride can be utilized as a starting material or intermediate in the synthesis of other complex organic molecules. Its unique structure allows for further functionalization and modification, making it a versatile component in organic chemistry.
Used in Material Science:
2-[4-(1,2-diphenylvinyl)phenoxy]ethyl(diethyl)ammonium chloride may also find applications in material science, particularly in the development of new polymers or materials with specific properties. Its ability to form stable complexes and its structural characteristics can contribute to the creation of innovative materials with tailored properties for various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 74056-26-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,4,0,5 and 6 respectively; the second part has 2 digits, 2 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 74056-26:
(7*7)+(6*4)+(5*0)+(4*5)+(3*6)+(2*2)+(1*6)=121
121 % 10 = 1
So 74056-26-1 is a valid CAS Registry Number.
InChI:InChI=1/C26H29NO.ClH/c1-3-21(2)27-18-19-28-25-16-14-24(15-17-25)26(23-12-8-5-9-13-23)20-22-10-6-4-7-11-22;/h4-17,20-21,27H,3,18-19H2,1-2H3;1H/b26-20-;
74056-26-1Relevant articles and documents
CLOMIPHENE SYNTHESIS USING A SINGLE SOLVENT
-
Paragraph 0023-0024, (2017/04/04)
The present invention provides a one-pot method for synthesizing clomiphene (a mixture of the isomers cis-clomiphene and trans-clomiphene) utilizing a single solvent. In a preferred embodiment, the single solvent is dichloromethane (DCM, also known as methylene chloride). The present invention provides an improved method for synthesizing clomiphene and purifying clomiphene isomers.