74240-64-5 Usage
Description
TRANS-4-(5-PROPYL-1,3-DIOXAN-2-YL)BENZONITRILE is a chemical compound with the molecular formula C16H19NO2. It is a nitrile derivative featuring a benzene ring and a dioxane moiety, known for its unique structure and potential pharmacological properties.
Uses
Used in Organic Synthesis:
TRANS-4-(5-PROPYL-1,3-DIOXAN-2-YL)BENZONITRILE is used as a building block in organic synthesis for its unique structure, facilitating the creation of various organic compounds.
Used in Pharmaceutical Research:
It serves as a valuable component in pharmaceutical research, potentially contributing to the development of new drugs due to its pharmacological properties.
Used as a Reagent in Chemical Reactions:
TRANS-4-(5-PROPYL-1,3-DIOXAN-2-YL)BENZONITRILE is utilized as a reagent, playing a crucial role in various chemical reactions.
Used as an Intermediate in Production:
TRANS-4-(5-PROPYL-1,3-DIOXAN-2-YL)BENZONITRILE acts as an intermediate in the production process of a range of organic compounds, contributing to the synthesis of diverse chemical products.
Used in Development of New Drugs:
TRANS-4-(5-PROPYL-1,3-DIOXAN-2-YL)BENZONITRILE may have potential applications in the development of new drugs, offering a foundation for creating innovative pharmaceuticals.
Used in Agrochemical Development:
It may also be employed in the development of agrochemicals, contributing to advancements in agricultural chemistry.
Used in Material Science:
TRANS-4-(5-PROPYL-1,3-DIOXAN-2-YL)BENZONITRILE could be utilized in material science for the creation of new materials, potentially enhancing various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 74240-64-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,4,2,4 and 0 respectively; the second part has 2 digits, 6 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 74240-64:
(7*7)+(6*4)+(5*2)+(4*4)+(3*0)+(2*6)+(1*4)=115
115 % 10 = 5
So 74240-64-5 is a valid CAS Registry Number.
InChI:InChI=1/C14H17NO2/c1-2-3-12-9-16-14(17-10-12)13-6-4-11(8-15)5-7-13/h4-7,12,14H,2-3,9-10H2,1H3
