74316-27-1 Usage
Description
CIS-3-AMINOCYCLOBUTANECARBOXYLIC ACID, also known as cis-3-aminocyclobutane-1-carboxylic acid, is an organic compound that serves as a crucial intermediate in the synthesis of various chemical and pharmaceutical products. It is characterized by its unique cyclobutane ring structure and amino functionality, which contribute to its versatile reactivity and potential applications in different industries.
Uses
Used in Organic Synthesis:
CIS-3-AMINOCYCLOBUTANECARBOXYLIC ACID is used as an organic synthesis intermediate for the production of various chemical compounds. Its unique structure allows for the formation of a wide range of derivatives, making it a valuable building block in the synthesis of complex organic molecules.
Used in Pharmaceutical Industry:
CIS-3-AMINOCYCLOBUTANECARBOXYLIC ACID is used as a pharmaceutical intermediate for the development of new drugs. Its versatile reactivity and structural features make it an attractive candidate for the design and synthesis of novel therapeutic agents, particularly in the areas of medicinal chemistry and drug discovery.
Used in Laboratory Research and Development:
CIS-3-AMINOCYCLOBUTANECARBOXYLIC ACID is utilized in laboratory research and development processes, where it is employed to study its chemical properties, reactivity, and potential applications in various fields. This research helps to expand the knowledge base and understanding of the compound, ultimately leading to the development of new applications and products.
Used in Chemical Production Process:
CIS-3-AMINOCYCLOBUTANECARBOXYLIC ACID is also used in the chemical production process, where it serves as a key intermediate in the manufacturing of various chemical products. Its incorporation into the production process allows for the efficient synthesis of target compounds, contributing to the overall efficiency and cost-effectiveness of the chemical manufacturing industry.
Synthesis
Azide 10a (0.30 g, 1.9 mmol) was dissolved in methanol (5 mL); then 6N HCl (2 mL) and 10% palladium on charcoal were added to the solution. The resulting mixture was stirred under 1 bar of hydrogen for 3 h, then the catalyst was filtered off, and the solvent was removed under reduced pressure. The residue was dissolvedin 6N HCl (5 mL) and refluxed upon stirring for 1 h, then evaporated in vacuum. The residue was purified by ion-exchange chromatography (Amberlite? IR-120(plus) ion-exchange resin, 3.5% aqueous ammonia as an eluent). cis-3-aminocyclobutanecarboxylic acid 1a as white powder, yield 0.16 g, 1.4 mmol, 71%.
Check Digit Verification of cas no
The CAS Registry Mumber 74316-27-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,4,3,1 and 6 respectively; the second part has 2 digits, 2 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 74316-27:
(7*7)+(6*4)+(5*3)+(4*1)+(3*6)+(2*2)+(1*7)=121
121 % 10 = 1
So 74316-27-1 is a valid CAS Registry Number.
InChI:InChI=1/C5H9NO2/c6-4-1-3(2-4)5(7)8/h3-4H,1-2,6H2,(H,7,8)/t3-,4+
74316-27-1Relevant articles and documents
Expedient synthesis of cis- and trans-3-aminocyclobutanecarboxylic acids
Radchenko, Dmytro S.,Tkachenko, Anton,Grygorenko, Oleksandr O.,Komarov, Igor V.
, p. 1644 - 1649 (2011/06/23)
An expedient approach to cis- and trans-3-aminocyclobutanecarboxylic acids was developed starting from 1,1-cyclobutanedicarboxylic acid. Stereochemistry of the title compounds was established by nuclear Overhauser effect spectroscopy experiments.
