74411-19-1 Usage
Description
Thiazole-5-carboxamide is a chemical compound belonging to the 1,3-thiazole family, characterized by the presence of an aminocarbonyl group at the 5th position. It is a heterocyclic compound with potential applications in various industries due to its unique chemical properties.
Uses
Used in Pharmaceutical Industry:
Thiazole-5-carboxamide is used as a building block for the synthesis of various pharmaceutical compounds. Its unique structure allows it to be a key component in the development of new drugs, particularly those targeting specific biological pathways or receptors.
Used in Chemical Synthesis:
In the field of organic chemistry, thiazole-5-carboxamide serves as an important intermediate for the synthesis of a wide range of chemical products. Its versatile structure makes it a valuable precursor in the creation of various molecules with different applications.
Used in Material Science:
Thiazole-5-carboxamide can be utilized in the development of novel materials with specific properties, such as conductivity, magnetism, or optical characteristics. Its incorporation into polymers or other materials can lead to the creation of advanced materials with potential applications in electronics, sensors, or other high-tech industries.
Used in Research and Development:
Due to its unique chemical structure, thiazole-5-carboxamide is often used in research and development to study its properties and potential applications. It can serve as a model compound for understanding the behavior of similar molecules and for testing new synthetic methods or reaction conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 74411-19-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,4,4,1 and 1 respectively; the second part has 2 digits, 1 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 74411-19:
(7*7)+(6*4)+(5*4)+(4*1)+(3*1)+(2*1)+(1*9)=111
111 % 10 = 1
So 74411-19-1 is a valid CAS Registry Number.
InChI:InChI=1/C4H4N2OS/c5-4(7)3-1-6-2-8-3/h1-2H,(H2,5,7)
74411-19-1Relevant articles and documents
IMIDAZOPYRIDINE COMPOUNDS, COMPOSITIONS AND METHODS OF USE
-
Page/Page column 113, (2011/10/10)
The invention provides compounds of Formulas Ia-Ib, stereoisomers or pharmaceutically acceptable salts thereof, wherein A, X, R1, R2, R4, R5 and R16 are defined herein, a pharmaceutical composition that includes a compound of Formulas Ia-Ib and a pharmaceutically acceptable carrier, adjuvant or vehicle, and methods of using the compound or composition in therapy.
