754-73-4Relevant articles and documents
PRODUCTION METHOD OF PERFLUOROALKADIENE COMPOUND
-
Paragraph 0046; 0053-0055, (2021/01/15)
PROBLEM TO BE SOLVED: To provide a method capable of obtaining a perfluoroalkandiene compound in a high yield while reducing the generation amount of impurities which are difficult to separate. SOLUTION: The production method is a method for producing a perfluoroalkandiene compound represented by the general formula (1): CF2=CF-(CF2)n-4-CF=CF2 (1) [in the formula, n represents an integer of 4 to 20.] and comprises a reaction step of reacting a compound represented by the general formula (2): CF2X1-CFX2-(CF2)n-4-CF2-CF2X3 (2) [in the formula, n is the same as defined above; X1, X2 and X3 are the same or different, X1 and X2 represent a halogen atom, and X3 represents a chlorine atom, a bromine atom or an iodine atom, provided that both X1 and X2 are not fluorine atoms] in the presence of a nitrogen-containing compound and zinc or a zinc alloy in an organic solvent in which the reaction step includes a mixing step of sequentially mixing a solution including zinc or a zinc alloy and an organic solvent, a nitrogen-containing compound and the compound represented by the general formula (2). SELECTED DRAWING: None COPYRIGHT: (C)2021,JPOandINPIT