75748-36-6 Usage
Description
D-Threonine Benzyl Ester Hydrochloride is an organic compound that serves as a key reactant in the synthesis of various pharmaceutical compounds. It is characterized by its unique chemical structure, which includes a threonine molecule with a benzyl ester group and a hydrochloride ion. D-Threonine Benzyl Ester Hydrochloride plays a crucial role in the development of new drugs and therapeutic agents.
Uses
Used in Pharmaceutical Industry:
D-Threonine Benzyl Ester Hydrochloride is used as a reactant for the preparation of 3-methyl-7-phenylacetamido-O-2-isocephem, a compound with antimicrobial activity. This makes it a valuable component in the development of new antibiotics and antimicrobial agents to combat resistant bacteria and infections.
Check Digit Verification of cas no
The CAS Registry Mumber 75748-36-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,5,7,4 and 8 respectively; the second part has 2 digits, 3 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 75748-36:
(7*7)+(6*5)+(5*7)+(4*4)+(3*8)+(2*3)+(1*6)=166
166 % 10 = 6
So 75748-36-6 is a valid CAS Registry Number.
InChI:InChI=1S/C11H15NO3.ClH/c1-8(13)10(12)11(14)15-7-9-5-3-2-4-6-9;/h2-6,8,10,13H,7,12H2,1H3;1H/t8-,10+;/m0./s1
