757950-13-3 Usage
Description
3-Fluoro-5-iodo-pyridine is an organic compound characterized by the presence of a pyridine ring with a fluorine atom at the 3-position and an iodine atom at the 5-position. This unique structure endows it with specific chemical properties that make it a valuable intermediate in the synthesis of various pharmaceutical compounds.
Uses
Used in Pharmaceutical Industry:
3-Fluoro-5-iodo-pyridine is used as a reagent for the synthesis of a novel labeled phosphodiesterase-IV inhibitor II. This application is significant because phosphodiesterase-IV inhibitors have potential therapeutic applications in treating various diseases, such as asthma and chronic obstructive pulmonary disease (COPD). The incorporation of 3-fluoro-5-iodo-pyridine in the synthesis process allows for the development of more effective and targeted treatments.
Check Digit Verification of cas no
The CAS Registry Mumber 757950-13-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 7,5,7,9,5 and 0 respectively; the second part has 2 digits, 1 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 757950-13:
(8*7)+(7*5)+(6*7)+(5*9)+(4*5)+(3*0)+(2*1)+(1*3)=203
203 % 10 = 3
So 757950-13-3 is a valid CAS Registry Number.
InChI:InChI=1/C5H3FIN/c6-4-1-5(7)3-8-2-4/h1-3H