75859-03-9 Usage
Description
9-[3-(CIS-3,5-DIMETHYL-1-PIPERAZINYL)PROPYL]-9H-CARBAZOLE DIHYDROCHLORIDE is a chemical compound with a complex structure, characterized by its carbazole core and a substituted piperazine group. This molecule is known for its potential interactions with biological systems, making it a candidate for various applications in the pharmaceutical and chemical industries.
Uses
Used in Pharmaceutical Applications:
9-[3-(CIS-3,5-DIMETHYL-1-PIPERAZINYL)PROPYL]-9H-CARBAZOLE DIHYDROCHLORIDE is used as a small molecule antagonist for the σ-1 receptor, playing a crucial role in inhibiting tumor cell survival. Its ability to target the σ-1 receptor makes it a potential therapeutic agent in the fight against cancer.
Used in Chemical Research:
In the field of chemical research, 9-[3-(CIS-3,5-DIMETHYL-1-PIPERAZINYL)PROPYL]-9H-CARBAZOLE DIHYDROCHLORIDE can be used as a starting material or a building block for the synthesis of more complex molecules with specific biological activities. Its unique structure allows for further functionalization and exploration of its potential applications in various chemical and pharmaceutical processes.
Used in Drug Development:
9-[3-(CIS-3,5-DIMETHYL-1-PIPERAZINYL)PROPYL]-9H-CARBAZOLE DIHYDROCHLORIDE may also be utilized in drug development, particularly in the design and optimization of new drugs targeting the σ-1 receptor. Its antagonistic properties can be leveraged to develop more effective treatments for cancer and other diseases where the σ-1 receptor plays a significant role.
Biological Activity
Antagonist at σ receptors (IC 50 values are 1480 and 386 nM at σ 1 and σ 2 receptors respectively). Also binds to the dopamine transporter (IC 50 = 57.6 nM) and inhibits dopamine uptake. Reduces the stimulatory effects of cocaine in vivo .
Check Digit Verification of cas no
The CAS Registry Mumber 75859-03-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,5,8,5 and 9 respectively; the second part has 2 digits, 0 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 75859-03:
(7*7)+(6*5)+(5*8)+(4*5)+(3*9)+(2*0)+(1*3)=169
169 % 10 = 9
So 75859-03-9 is a valid CAS Registry Number.
InChI:InChI=1/C21H27N3.2ClH/c1-16-14-23(15-17(2)22-16)12-7-13-24-20-10-5-3-8-18(20)19-9-4-6-11-21(19)24;;/h3-6,8-11,16-17,22H,7,12-15H2,1-2H3;2*1H/t16-,17+;;