75890-68-5 Usage
Description
2-Formamidothiazol-4-acetic acid is an organic compound with the molecular formula C4H6N2O3S. It is a derivative of thiazol, a heterocyclic compound with a core structure consisting of a benzene ring fused to a thiazole ring. 2-Formamidothiazol-4-acetic acid is characterized by the presence of an amide group and a carboxylic acid group, which contribute to its reactivity and potential applications in various fields.
Uses
Used in Pharmaceutical Industry:
2-Formamidothiazol-4-acetic acid is used as a reagent for the preparation of anti-Helicobacter pylori agents. Helicobacter pylori is a type of bacteria that can cause infections in the stomach and lead to various gastrointestinal issues, including peptic ulcers and gastritis. 2-Formamidothiazol-4-acetic acid plays a crucial role in the synthesis of these therapeutic agents, targeting the bacteria and helping to alleviate the associated symptoms and complications.
Check Digit Verification of cas no
The CAS Registry Mumber 75890-68-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,5,8,9 and 0 respectively; the second part has 2 digits, 6 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 75890-68:
(7*7)+(6*5)+(5*8)+(4*9)+(3*0)+(2*6)+(1*8)=175
175 % 10 = 5
So 75890-68-5 is a valid CAS Registry Number.
InChI:InChI=1/C6H6N2O3S/c9-3-7-6-8-4(2-12-6)1-5(10)11/h2-3H,1H2,(H,10,11)(H,7,8,9)
