760-32-7 Usage
Description
Diethylmethylsilane is a clear colorless liquid with chemical properties similar to triethylsilane but with a lower boiling point. It is a type of organosilicon compound that is known for its stability and reactivity in various chemical reactions.
Uses
Used in Chemical Synthesis:
Diethylmethylsilane is used as a reagent in the chemical synthesis industry for its ability to participate in a wide range of reactions, such as hydrosilation and deprotection reactions. Its lower boiling point compared to triethylsilane makes it a more accessible and cost-effective choice for certain applications.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, Diethylmethylsilane is used as a protecting group for organic compounds during synthesis. Its stability and reactivity allow for selective protection and deprotection of functional groups, which is crucial in the development of complex drug molecules.
Used in Material Science:
Diethylmethylsilane is also utilized in the material science field, particularly in the synthesis of silicone-based materials and polymers. Its unique properties contribute to the development of materials with specific characteristics, such as thermal stability, chemical resistance, and optical clarity.
Used in Analytical Chemistry:
As a clear colorless liquid, Diethylmethylsilane is employed in analytical chemistry as a reference material or internal standard for various analytical techniques, including gas chromatography and mass spectrometry. Its distinct properties help in the accurate identification and quantification of target compounds in complex mixtures.
Check Digit Verification of cas no
The CAS Registry Mumber 760-32-7 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 7,6 and 0 respectively; the second part has 2 digits, 3 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 760-32:
(5*7)+(4*6)+(3*0)+(2*3)+(1*2)=67
67 % 10 = 7
So 760-32-7 is a valid CAS Registry Number.
InChI:InChI=1/C5H13Si/c1-4-6(3)5-2/h4-5H2,1-3H3
760-32-7Relevant articles and documents
Silylpalladium Cations Enable the Oxidative Addition of C(sp3)-O Bonds
Wierschen, Andreas L.,Romano, Neyen,Lee, Stephen J.,Gagné, Michel R.
supporting information, p. 16024 - 16032 (2019/11/11)
The synthesis and characterization of the room-temperature and solution-stable silylpalladium cations (PCy3)2Pd-SiR3+(C6F5)4B- (SiR3 = SiMe2Et, SiHEt2) and (Xantphos)Pd-SiR3+(BArf4) (SiR3 = SiMe2Et, SiHEt2; Xantphos = 4,5-bis(diphenylphosphino)-9,9-dimethylxanthene; BArf4 = (3,5-(CF3)2C6H3)4B-) are reported. Spectroscopic and ligand addition experiments suggest that silylpalladium complexes of the type (PCy3)2Pd-SiR3+ are three-coordinate and T-shaped. Addition of dialkyl ethers to both the PCy3 and Xantphos-based silylpalladium cations resulted in the cleavage of C(sp3)-O bonds and the generation of cationic Pd-alkyl complexes. Mechanistically enabling is the ability of silylpalladium cations to behave as sources of both electrophilic silylium ions and nucleophilic LnPd(0).