76006-13-8 Usage
Description
3-Bromo-1H-pyrazolo[3,4-c]pyridine is a heterocyclic compound characterized by the presence of a pyrazolo[3,4-c]pyridine ring system with a bromine atom at the 3-position. This unique molecular structure endows it with specific chemical properties and reactivity, making it a valuable intermediate in organic synthesis and medicinal chemistry.
Uses
Used in Pharmaceutical Industry:
3-Bromo-1H-pyrazolo[3,4-c]pyridine is used as a key reactant for the synthesis of azaindazoles, which are potent inhibitors of bacterial DNA ligase. These inhibitors play a crucial role in the development of new antimicrobial agents, as they target essential enzymes involved in bacterial DNA replication and repair processes. By inhibiting bacterial DNA ligase, azaindazoles can effectively disrupt the growth and survival of various pathogenic bacteria, offering a promising strategy for combating antibiotic-resistant infections.
Check Digit Verification of cas no
The CAS Registry Mumber 76006-13-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,6,0,0 and 6 respectively; the second part has 2 digits, 1 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 76006-13:
(7*7)+(6*6)+(5*0)+(4*0)+(3*6)+(2*1)+(1*3)=108
108 % 10 = 8
So 76006-13-8 is a valid CAS Registry Number.
InChI:InChI=1/C6H4BrN3/c7-6-4-1-2-8-3-5(4)9-10-6/h1-3H,(H,9,10)
76006-13-8Relevant articles and documents
X-ray crystal structure and moldesign calculation of 1H-pyrazolo [3,4-c]pyridine
Milhavet,Bernal,Gueiffier,Contastin,Chapat,Teulade,Carpy,Grassy
, p. 885 - 887 (1989)
-
Synthesis, reactivity and 13C-NMR of 1H-pyrazolo[3,4-c]pyridine derivatives
Milhavet, Jean-Claude,Gueiffier, Alain,Bernal, Lysiane,Teulade, Jean-Claude
, p. 1661 - 1667 (2007/10/03)
The synthesis of various 1H-pyrazolo [.-c.]pyridines was reported. 3- Cyano derivatives were obtained from the corresponding nitro compounds by Sandmeyer Reaction using Na3[Cu(CN)4] at pH 1. The 13C-NMR data of this series were also described.
