7620-77-1 Usage
Description
LITHIUM 12-HYDROXYSTEARATE is a lithium salt derived from 12-Hydroxystearic Acid, a fatty acid commonly found in various plant sources. It is known for its unique properties, such as its ability to form organogels and its compatibility with edible vegetable oils.
Uses
Used in Edible Vegetable Oils:
LITHIUM 12-HYDROXYSTEARATE is used as an additive in the edible vegetable oil industry to improve the oil's stability and extend its shelf life. Its ability to form organogels allows for better control over the oil's viscosity and texture, ensuring a consistent and high-quality product.
Used in Organogel Formation:
In the field of material science, LITHIUM 12-HYDROXYSTEARATE is used as a key component in the formation of organogels. These organogels have potential applications in various industries, such as pharmaceuticals, cosmetics, and food technology, due to their unique properties, including their ability to encapsulate and release active ingredients in a controlled manner.
Check Digit Verification of cas no
The CAS Registry Mumber 7620-77-1 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 7,6,2 and 0 respectively; the second part has 2 digits, 7 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 7620-77:
(6*7)+(5*6)+(4*2)+(3*0)+(2*7)+(1*7)=101
101 % 10 = 1
So 7620-77-1 is a valid CAS Registry Number.
InChI:InChI=1/C18H36O3.Li/c1-2-3-4-11-14-17(19)15-12-9-7-5-6-8-10-13-16-18(20)21;/h17,19H,2-16H2,1H3,(H,20,21);/q;+1/p-1/t17-;/m0./s1
