7627-80-7 Usage
Description
Tetrafluoropyridazine is a perfluoro-aromatic nitrogen heterocyclic compound derived from its perchloro-analogue through an exchange reaction with potassium fluoride in the absence of solvent. It is known for its ability to readily undergo nucleophilic substitution, making it a versatile building block in various chemical reactions and applications.
Uses
Used in Chemical Synthesis:
Tetrafluoropyridazine is used as a key intermediate in the synthesis of various perfluoro-aromatic nitrogen heterocyclic compounds. Its high reactivity in nucleophilic substitution reactions allows for the creation of a wide range of complex molecules with diverse properties and applications.
Used in Ultrathin Plasma Polymer Films:
Tetrafluoropyridazine is utilized in the preparation of ultrathin plasma polymer films, which have potential applications in various industries due to their unique properties, such as enhanced chemical resistance, biocompatibility, and surface properties.
Used in Polyfluoroalkylations:
Tetrafluoropyridazine is employed in polyfluoroalkylation reactions, where the variation in the orientation of products formed with the olefin used is an important aspect. This allows for the synthesis of specific compounds with tailored properties, which can be useful in various applications, such as pharmaceuticals, materials science, and specialty chemicals.
Check Digit Verification of cas no
The CAS Registry Mumber 7627-80-7 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 7,6,2 and 7 respectively; the second part has 2 digits, 8 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 7627-80:
(6*7)+(5*6)+(4*2)+(3*7)+(2*8)+(1*0)=117
117 % 10 = 7
So 7627-80-7 is a valid CAS Registry Number.
InChI:InChI=1/C4F4N2/c5-1-2(6)4(8)10-9-3(1)7
