766-16-5 Usage
Description
4-FLUORO-2-METHYLPYRIDINE is an organic compound with the molecular formula C6H6FN. It is a derivative of pyridine, featuring a fluorine atom at the 4th position and a methyl group at the 2nd position. 4-FLUORO-2-METHYLPYRIDINE is known for its potential applications in various chemical and pharmaceutical processes due to its unique structural properties.
Uses
Used in Chemical Synthesis:
4-FLUORO-2-METHYLPYRIDINE is used as a synthetic building block for the development of various pharmaceuticals and agrochemicals. Its unique structure allows for further functionalization and modification, making it a versatile compound in the synthesis of complex molecules.
Used in Medicinal Chemistry:
In the field of medicinal chemistry, 4-FLUORO-2-METHYLPYRIDINE is used as a key intermediate in the design and synthesis of novel drug candidates. Its presence in a molecule can influence the pharmacokinetic and pharmacodynamic properties, potentially leading to improved drug efficacy and selectivity.
Used in the Correlations with and Limitations of the α Scale of Solvent Hydrogen Bond Donor Acidities:
4-FLUORO-2-METHYLPYRIDINE is utilized in the study of solvent hydrogen bond donor acidities, specifically in the context of the α scale. This scale is a quantitative measure of the ability of solvents to act as hydrogen bond donors. 4-FLUORO-2-METHYLPYRIDINE's properties can help researchers understand the limitations and correlations of the α scale, ultimately contributing to the advancement of solvent selection and optimization in chemical reactions and processes.
Check Digit Verification of cas no
The CAS Registry Mumber 766-16-5 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 7,6 and 6 respectively; the second part has 2 digits, 1 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 766-16:
(5*7)+(4*6)+(3*6)+(2*1)+(1*6)=85
85 % 10 = 5
So 766-16-5 is a valid CAS Registry Number.
InChI:InChI=1/C6H6FN/c1-5-4-6(7)2-3-8-5/h2-4H,1H3
