76750-84-0 Usage
Description
4-AMINO-2-DIMETHYLAMINO-6-HYDROXYPYRIMIDINE, also known as 2-Dimethylamino-4-hydroxy-6-aminopyrimidine (CAS# 76750-84-0), is a white solid compound with significant utility in the field of organic synthesis. Its unique chemical structure and properties make it a valuable building block for the development of various chemical compounds and materials.
Uses
Used in Organic Synthesis:
4-AMINO-2-DIMETHYLAMINO-6-HYDROXYPYRIMIDINE is used as a synthetic building block for the creation of a wide range of chemical compounds. Its versatile structure allows for the development of new molecules with potential applications in various industries, including pharmaceuticals, agrochemicals, and materials science.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 4-AMINO-2-DIMETHYLAMINO-6-HYDROXYPYRIMIDINE is used as a key intermediate in the synthesis of various drug candidates. Its unique chemical properties enable the development of novel therapeutic agents with potential applications in the treatment of various diseases and medical conditions.
Used in Agrochemical Industry:
4-AMINO-2-DIMETHYLAMINO-6-HYDROXYPYRIMIDINE is also utilized in the agrochemical industry for the synthesis of new pesticides, herbicides, and other crop protection agents. Its incorporation into these products can lead to the development of more effective and environmentally friendly solutions for agricultural challenges.
Used in Materials Science:
In the field of materials science, 4-AMINO-2-DIMETHYLAMINO-6-HYDROXYPYRIMIDINE is used as a component in the development of advanced materials with unique properties. These materials can find applications in various sectors, such as electronics, energy storage, and advanced coatings.
Overall, 4-AMINO-2-DIMETHYLAMINO-6-HYDROXYPYRIMIDINE is a versatile and valuable compound with a wide range of applications across different industries, thanks to its unique chemical properties and its role as a synthetic building block.
Check Digit Verification of cas no
The CAS Registry Mumber 76750-84-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,6,7,5 and 0 respectively; the second part has 2 digits, 8 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 76750-84:
(7*7)+(6*6)+(5*7)+(4*5)+(3*0)+(2*8)+(1*4)=160
160 % 10 = 0
So 76750-84-0 is a valid CAS Registry Number.
InChI:InChI=1/C6H10N4O/c1-10(2)6-8-4(7)3-5(11)9-6/h3H,1-2H3,(H3,7,8,9,11)
