77-03-2 Usage
General Description
3,3-diethylpiperidine-2,4-dione, also known as DEPD, is a chemical compound with a cyclic structure containing a piperidine ring and a diethyl substituent. It is a yellow crystalline solid and is primarily used as an intermediate in the synthesis of pharmaceuticals and agrochemicals. DEPD is known for its potential as an anticonvulsant and its ability to act as a GABA uptake inhibitor, making it a promising candidate for the treatment of epilepsy and other neurological disorders. Additionally, it has been studied for its potential use in the development of insecticides and herbicides due to its biological activity against certain pests and weeds. However, further research is needed to fully understand and harness the potential applications of 3,3-diethylpiperidine-2,4-dione in various fields.
Check Digit Verification of cas no
The CAS Registry Mumber 77-03-2 includes 5 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 2 digits, 7 and 7 respectively; the second part has 2 digits, 0 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 77-03:
(4*7)+(3*7)+(2*0)+(1*3)=52
52 % 10 = 2
So 77-03-2 is a valid CAS Registry Number.
InChI:InChI=1/C9H15NO2/c1-3-9(4-2)7(11)5-6-10-8(9)12/h3-6H2,1-2H3,(H,10,12)
