77154-18-8 Usage
Description
2-furanylmethyl 4-[(1-butyl-5-cyano-1,6-dihydro-2-hydroxy-4-methyl-6-oxopyridin-3-yl)azo]benzoate is a complex organic chemical compound characterized by the presence of a furanyl group, a cyano group, and a benzoate moiety. It is derived from benzoic acid and features an azo group along with a butyl chain attached to a pyridine ring. 2-furanylmethyl 4-[(1-butyl-5-cyano-1,6-dihydro-2-hydroxy-4-methyl-6-oxopyridin-3-yl)azo]benzoate holds potential biological activity and may be utilized in various applications due to its unique structural features and interactions with biological systems.
Uses
Used in Pharmaceutical Industry:
2-furanylmethyl 4-[(1-butyl-5-cyano-1,6-dihydro-2-hydroxy-4-methyl-6-oxopyridin-3-yl)azo]benzoate is used as a potential pharmaceutical agent for its possible ability to interact with biological systems. Its complex structure may allow it to target specific receptors or enzymes, making it a candidate for the development of new drugs.
Used in Agrochemical Industry:
In the agrochemical sector, 2-furanylmethyl 4-[(1-butyl-5-cyano-1,6-dihydro-2-hydroxy-4-methyl-6-oxopyridin-3-yl)azo]benzoate may serve as a chemical intermediate or a bioactive component in the formulation of pesticides or other agricultural chemicals. Its potential to affect biological systems could be harnessed to control pests or enhance crop protection.
Used as a Chemical Intermediate:
2-furanylmethyl 4-[(1-butyl-5-cyano-1,6-dihydro-2-hydroxy-4-methyl-6-oxopyridin-3-yl)azo]benzoate is used as a chemical intermediate in the synthesis of other compounds. Its unique structure may be a key component in creating novel molecules with specific applications in various industries, including pharmaceuticals, materials science, and agrochemicals.
Further research is necessary to fully explore the properties and potential uses of 2-furanylmethyl 4-[(1-butyl-5-cyano-1,6-dihydro-2-hydroxy-4-methyl-6-oxopyridin-3-yl)azo]benzoate, as its complex nature suggests a wide range of possible applications that are yet to be discovered and validated.
Check Digit Verification of cas no
The CAS Registry Mumber 77154-18-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,7,1,5 and 4 respectively; the second part has 2 digits, 1 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 77154-18:
(7*7)+(6*7)+(5*1)+(4*5)+(3*4)+(2*1)+(1*8)=138
138 % 10 = 8
So 77154-18-8 is a valid CAS Registry Number.
InChI:InChI=1/C23H22N4O5/c1-3-4-11-27-21(28)19(13-24)15(2)20(22(27)29)26-25-17-9-7-16(8-10-17)23(30)32-14-18-6-5-12-31-18/h5-10,12,25H,3-4,11,14H2,1-2H3/b26-20-