77160-83-9 Usage
Description
5-(N-(1'-phenylcyclohexyl)amino)pentanoic acid, also known as a fatty acid derivative, is a compound derived from valeric acid with a unique substitution at the C-5 position. This substitution involves an N-(1-phenylcyclohexyl)amino group, which distinguishes it from other fatty acid derivatives. The structure and properties of this compound make it suitable for various applications across different industries.
Uses
Used in Pharmaceutical Industry:
5-(N-(1'-phenylcyclohexyl)amino)pentanoic acid is used as a pharmaceutical compound for its potential therapeutic applications. The unique structure of this fatty acid derivative allows it to interact with specific biological targets, making it a promising candidate for the development of new drugs.
Used in Chemical Synthesis:
In the field of chemical synthesis, 5-(N-(1'-phenylcyclohexyl)amino)pentanoic acid serves as a key intermediate or building block for the creation of more complex molecules. Its unique functional groups and structural features enable the synthesis of a wide range of compounds with diverse applications.
Used in Material Science:
5-(N-(1'-phenylcyclohexyl)amino)pentanoic acid is used as a component in the development of novel materials with specific properties. Its incorporation into polymers or other materials can lead to enhanced performance characteristics, such as improved mechanical strength, thermal stability, or chemical resistance.
Used in Cosmetics Industry:
In the cosmetics industry, 5-(N-(1'-phenylcyclohexyl)amino)pentanoic acid may be utilized as an active ingredient in various formulations. Its unique properties could contribute to the development of innovative products with improved efficacy, such as anti-aging creams, skin care treatments, or hair care products.
Used in Research and Development:
5-(N-(1'-phenylcyclohexyl)amino)pentanoic acid is used as a research tool for studying the structure-activity relationships of fatty acid derivatives. Its unique structure allows scientists to explore the effects of different functional groups and substitutions on the compound's biological activity, potentially leading to the discovery of new therapeutic agents or materials with novel properties.
Check Digit Verification of cas no
The CAS Registry Mumber 77160-83-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,7,1,6 and 0 respectively; the second part has 2 digits, 8 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 77160-83:
(7*7)+(6*7)+(5*1)+(4*6)+(3*0)+(2*8)+(1*3)=139
139 % 10 = 9
So 77160-83-9 is a valid CAS Registry Number.
InChI:InChI=1/C17H25NO2/c19-16(20)11-5-8-14-18-17(12-6-2-7-13-17)15-9-3-1-4-10-15/h1,3-4,9-10,18H,2,5-8,11-14H2,(H,19,20)
77160-83-9Relevant articles and documents
Application of chemical P450 model systems to studies on drug metabolism. I. Phencyclidine: A multi-functional model substrate
Masumoto,Takeuchi,Ohta,Hirobe
, p. 1788 - 1794 (2007/10/02)
-
Mammalian metabolism of phencyclidine
Baker,Wohlford,Bradbury,Wirth
, p. 666 - 669 (2007/10/02)
In dogs, the major metabolite of phencyclidine was found to be 5-[N-(1'-phenylcyclohexyl) amino]pentanoic acid (1). The γ-aminobutyric acid like metabolite was also pharmacologically evaluated to determine if the purported GABA-ergic mediated effects of p
