774-07-2 Usage
Description
ETHYL 4-AMINO-2-MERCAPTOPYRIMIDINE-5-CARBOXYLATE, with the chemical abstracts service number 774-07-2, is an organic compound that plays a significant role in various chemical reactions and processes. Its unique molecular structure, featuring an amino group, a thiol (mercapto) group, and a carboxylate group, endows it with versatile reactivity and potential applications in different fields.
Uses
Used in Organic Synthesis:
ETHYL 4-AMINO-2-MERCAPTOPYRIMIDINE-5-CARBOXYLATE is used as a key intermediate in the synthesis of various organic compounds. Its presence in reactions can facilitate the formation of new chemical bonds and the creation of complex molecules, making it a valuable component in the development of pharmaceuticals, agrochemicals, and other specialty chemicals.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, ETHYL 4-AMINO-2-MERCAPTOPYRIMIDINE-5-CARBOXYLATE is used as a building block for the synthesis of therapeutic agents. Its ability to form stable covalent bonds with other molecules allows for the creation of new drug candidates with potential medicinal properties, contributing to the advancement of novel treatments for various diseases.
Used in Agrochemical Industry:
ETHYL 4-AMINO-2-MERCAPTOPYRIMIDINE-5-CARBOXYLATE also finds application in the agrochemical sector, where it is utilized in the synthesis of active ingredients for pesticides and herbicides. Its reactivity and functional groups can be leveraged to create compounds that effectively control pests and weeds, thereby enhancing crop protection and yield.
Used in Research and Development:
In research and development settings, ETHYL 4-AMINO-2-MERCAPTOPYRIMIDINE-5-CARBOXYLATE serves as a valuable tool for studying chemical reactions and exploring new synthetic pathways. Its unique properties can be employed to investigate reaction mechanisms, optimize reaction conditions, and develop innovative synthetic strategies, furthering the understanding of organic chemistry and its applications.
Synthesis Reference(s)
The Journal of Organic Chemistry, 21, p. 567, 1956 DOI: 10.1021/jo01111a021
Check Digit Verification of cas no
The CAS Registry Mumber 774-07-2 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 7,7 and 4 respectively; the second part has 2 digits, 0 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 774-07:
(5*7)+(4*7)+(3*4)+(2*0)+(1*7)=82
82 % 10 = 2
So 774-07-2 is a valid CAS Registry Number.
InChI:InChI=1/C7H9N3O2S/c1-2-12-6(11)4-3-9-7(13)10-5(4)8/h3H,2H2,1H3,(H3,8,9,10,13)
774-07-2Relevant articles and documents
Investigation on possibility of rearrangement of pyrimidine-5-carboxylic acids esters
Scherbinina,Dar'In,Lobanov
experimental part, p. 1109 - 1115 (2011/10/02)
A previously reported rearrangement of pyrimidine-5-carboxylic acids esters to 5-acylpyrimidones does not, in fact, occur in any of the examples studied by us.
Xi:Irritant;
