77633-05-7 Usage
General Description
2,4,6-Cycloheptatrien-1-one, 3-[3-(1,3-benzodioxol-5-yl)-1-oxo-2-propenyl]-2-hydroxy- is a chemical compound with a complex structure. It contains a cycloheptatrienone ring with a hydroxyl group and a 1,3-benzodioxol-5-yl group attached to it. The compound also has a 2-propenyl-1-oxo moiety. This chemical is not commonly known, but its structure suggests potential reactivity and possible applications in organic synthesis or medicinal chemistry. However, more research and understanding of its properties and behavior are needed to fully comprehend its potential uses.
Check Digit Verification of cas no
The CAS Registry Mumber 77633-05-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,7,6,3 and 3 respectively; the second part has 2 digits, 0 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 77633-05:
(7*7)+(6*7)+(5*6)+(4*3)+(3*3)+(2*0)+(1*5)=147
147 % 10 = 7
So 77633-05-7 is a valid CAS Registry Number.
InChI:InChI=1/C17H12O5/c18-13(12-3-1-2-4-14(19)17(12)20)7-5-11-6-8-15-16(9-11)22-10-21-15/h1-9H,10H2,(H,19,20)/b7-5+