77667-98-2 Usage
Description
2'-O-METHYLLACTOSE, also known as Methyl β-lactoside, is a derivative of lactose, a naturally occurring disaccharide found in milk and dairy products. It is characterized by the presence of a methyl group at the 2' position, which distinguishes it from other lactose derivatives. This unique structural feature endows 2'-O-METHYLLACTOSE with specific properties and potential applications in various fields.
Uses
Used in Pharmaceutical Industry:
2'-O-METHYLLACTOSE is used as a substrate for the enzyme β-D-galactosidase, which is derived from E. coli. This application is particularly relevant in the development and study of drugs targeting this enzyme, as it can help researchers understand the enzyme's function and its role in various biological processes.
Additionally, 2'-O-METHYLLACTOSE can be used as an inhibitor of β-D-galactosidase, which may have therapeutic implications in conditions where the inhibition of this enzyme is desired. By acting as an inhibitor, 2'-O-METHYLLACTOSE can potentially modulate the activity of β-D-galactosidase, leading to the development of novel treatments for specific diseases or conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 77667-98-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,7,6,6 and 7 respectively; the second part has 2 digits, 9 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 77667-98:
(7*7)+(6*7)+(5*6)+(4*6)+(3*7)+(2*9)+(1*8)=192
192 % 10 = 2
So 77667-98-2 is a valid CAS Registry Number.
InChI:InChI=1/C13H24O11/c1-22-12-10(21)9(20)7(4-16)23-13(12)24-11(6(18)3-15)8(19)5(17)2-14/h2,5-13,15-21H,3-4H2,1H3
