7801-91-4 Usage
General Description
Z-GLY-SAR-OH is a chemical compound with the molecular formula C14H17N3O6. It is an amino acid derivative with a zwitterionic structure, containing a glycine residue with a Z blocking group, a sarcosine residue, and a carboxylic acid group. Z-GLY-SAR-OH has potential applications in the pharmaceutical industry as a building block for the synthesis of peptide-based drugs and as a substrate for enzyme catalyzed reactions. It also possesses chiral properties, making it suitable for use in asymmetric catalysis and the production of enantiopure compounds. Additionally, Z-GLY-SAR-OH may have potential bioactivity and antimicrobial properties, although further research is needed to fully understand its potential applications.
Check Digit Verification of cas no
The CAS Registry Mumber 7801-91-4 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 7,8,0 and 1 respectively; the second part has 2 digits, 9 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 7801-91:
(6*7)+(5*8)+(4*0)+(3*1)+(2*9)+(1*1)=104
104 % 10 = 4
So 7801-91-4 is a valid CAS Registry Number.
InChI:InChI=1/C13H16N2O5/c1-15(8-12(17)18)11(16)7-14-13(19)20-9-10-5-3-2-4-6-10/h2-6H,7-9H2,1H3,(H,14,19)(H,17,18)
