78266-06-5 Usage
Description
(3-Bromo-2,4,6-trimethylphenylcarbamoyl)methyliminodiacetic acid is a complex organic compound with a unique chemical structure. It is characterized by its colorless or brownish crystalline appearance and possesses specific chemical properties that make it suitable for various applications in the medical and diagnostic fields.
Uses
Used in Diagnostic Applications:
(3-Bromo-2,4,6-trimethylphenylcarbamoyl)methyliminodiacetic acid is used as a diagnostic aid for the determination of hepatobiliary function. It plays a crucial role in the assessment of hepatobiliary transport, which is essential for understanding the proper functioning of the liver and bile ducts.
Used in Medical Diagnostics:
In the medical diagnostic field, (3-Bromo-2,4,6-trimethylphenylcarbamoyl)methyliminodiacetic acid is employed for its ability to aid in the evaluation of liver and gallbladder health. Its use in diagnostic tests helps healthcare professionals identify potential issues and develop appropriate treatment plans for patients with hepatobiliary concerns.
Used in Pharmaceutical Research:
Due to its unique chemical properties, (3-Bromo-2,4,6-trimethylphenylcarbamoyl)methyliminodiacetic acid may also be utilized in pharmaceutical research for the development of new drugs or therapies targeting hepatobiliary disorders. Its potential applications in this area could lead to advancements in the treatment of various liver and gallbladder-related conditions.
Used in Analytical Chemistry:
(3-BROMO-2,4,6-TRIMETHYLPHENYLCARBAMOYL)METHYLIMINODIACETIC ACID's distinctive characteristics make it a valuable tool in analytical chemistry, where it can be employed for the detection and quantification of specific substances or for the development of new analytical methods and techniques.
Check Digit Verification of cas no
The CAS Registry Mumber 78266-06-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,8,2,6 and 6 respectively; the second part has 2 digits, 0 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 78266-06:
(7*7)+(6*8)+(5*2)+(4*6)+(3*6)+(2*0)+(1*6)=155
155 % 10 = 5
So 78266-06-5 is a valid CAS Registry Number.
InChI:InChI=1/C15H19BrN2O5/c1-8-4-9(2)15(10(3)14(8)16)17-11(19)5-18(6-12(20)21)7-13(22)23/h4H,5-7H2,1-3H3,(H,17,19)(H,20,21)(H,22,23)/p-1