785038-49-5 Usage
General Description
"(R)-3-Amino-4-(3-chlorophenyl)butanoic Acid" is a chemical compound that belongs to the family of Phenylpropanoic acids. The "R" before the rest of the chemical name signifies its chiral configuration. Like other chiral molecules, it has an asymmetrical carbon atom, meaning it can exist in two different forms that are mirror images of each other. The specific properties of this chemical, such as its reactivity, boiling and melting points, and solubility, are subject to its exact molecular structure and the conditions under which it's studied. It could be potentially used in pharmaceutical synthesis and drug discovery, depending on its pharmacological properties.
Check Digit Verification of cas no
The CAS Registry Mumber 785038-49-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 7,8,5,0,3 and 8 respectively; the second part has 2 digits, 4 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 785038-49:
(8*7)+(7*8)+(6*5)+(5*0)+(4*3)+(3*8)+(2*4)+(1*9)=195
195 % 10 = 5
So 785038-49-5 is a valid CAS Registry Number.
InChI:InChI=1/C10H12ClNO2/c11-8-3-1-2-7(4-8)5-9(12)6-10(13)14/h1-4,9H,5-6,12H2,(H,13,14)/t9-/m1/s1
