786-66-3 Usage
Molecular Structure
15,16-dihydrocyclopenta(a)phenanthren-17-one has a complex molecular structure, consisting of a cyclopenta-fused polycyclic aromatic hydrocarbon derived from the phenanthrene molecule.
Class
It belongs to the class of cyclopenta-fused polycyclic aromatic hydrocarbons.
Reactivity
Due to its unique structure, 15,16-dihydrocyclopenta(a)phenanthren-17-one exhibits specific reactivity, making it an important precursor in the synthesis of various organic compounds and pharmaceuticals.
Applications
The compound is used in the production of steroids and hormones, as well as in the development of new materials and drugs.
Potential Applications
It has potential applications in the field of organic chemistry and chemical research, making it a valuable tool for scientists and researchers in the industry.
Synthesis
15,16-dihydrocyclopenta(a)phenanthren-17-one serves as an important precursor in the synthesis of various organic compounds and pharmaceuticals.
Industrial Importance
The compound is valuable in the industry for its role in the development of new materials and drugs, as well as its potential applications in chemical research.
Chemical Properties
As a cyclopenta-fused polycyclic aromatic hydrocarbon, 15,16-dihydrocyclopenta(a)phenanthren-17-one possesses specific chemical properties that contribute to its reactivity and utility in various applications.
Structural Features
The compound's structure includes a cyclopenta-fused ring system, which is derived from the phenanthrene molecule and contributes to its unique properties.
Research Significance
15,16-dihydrocyclopenta(a)phenanthren-17-one is a significant compound in the field of organic chemistry, as it provides insights into the behavior and properties of cyclopenta-fused polycyclic aromatic hydrocarbons.
Check Digit Verification of cas no
The CAS Registry Mumber 786-66-3 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 7,8 and 6 respectively; the second part has 2 digits, 6 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 786-66:
(5*7)+(4*8)+(3*6)+(2*6)+(1*6)=103
103 % 10 = 3
So 786-66-3 is a valid CAS Registry Number.
InChI:InChI=1/C17H12O/c18-17-10-9-15-14-6-5-11-3-1-2-4-12(11)13(14)7-8-16(15)17/h1-8H,9-10H2
786-66-3Relevant articles and documents
A NEW SYNTHESIS OF CYCLOPENTA PHENANTHRENE AND ITS CARCINOGENIC DERIVATIVES
Lee, Homgmee,Harvey, Roland G.
, p. 3207 - 3210 (2007/10/02)
A novel synthesis of ciclopenta phenanthrene and its carcinogenic 11-methyl and 17-keto derivatives is described.
