78610-70-5 Usage
Description
2-Oxoindoline-3-carbaldehyde is an organic compound that serves as a key intermediate in the synthesis of various pharmaceuticals and chemical compounds. It is characterized by its unique structure, featuring an indoline core with a carbonyl group at the 2-position and an aldehyde group at the 3-position. 2-oxoindoline-3-carbaldehyde plays a crucial role in the development of new therapeutic agents and has potential applications in the pharmaceutical industry.
Uses
Used in Pharmaceutical Industry:
2-Oxoindoline-3-carbaldehyde is used as a key intermediate in the preparation of morpholine derivatives or their salts. These derivatives act as ATM (Ataxia Telangiectasia Mutated) inhibitors, which are important for the development of therapeutic agents and anticancer drug sensitivity enhancers. ATM inhibitors have the potential to improve the effectiveness of cancer treatments by modulating the DNA damage response and cell cycle regulation pathways, leading to enhanced therapeutic outcomes for patients with various types of cancer.
Check Digit Verification of cas no
The CAS Registry Mumber 78610-70-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,8,6,1 and 0 respectively; the second part has 2 digits, 7 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 78610-70:
(7*7)+(6*8)+(5*6)+(4*1)+(3*0)+(2*7)+(1*0)=145
145 % 10 = 5
So 78610-70-5 is a valid CAS Registry Number.
InChI:InChI=1/C9H7NO2/c11-5-7-6-3-1-2-4-8(6)10-9(7)12/h1-5,7H,(H,10,12)
