791050-65-2 Usage
Description
5(4H)-Oxazolone,2-(1-aminoethyl)-4-methyl-(9CI), also known as 2-(1-aminoethyl)-4-methyl-5(4H)-oxazolone in the IUPAC nomenclature, is a chemical compound with the molecular formula C8H11NO2. It is a derivative of oxazolone, a five-membered heterocyclic compound containing one oxygen and one nitrogen atom. 5(4H)-Oxazolone,2-(1-aminoethyl)-4-methyl-(9CI) is a white crystalline powder that is relatively stable under normal conditions.
Uses
Used in Organic Synthesis:
5(4H)-Oxazolone,2-(1-aminoethyl)-4-methyl-(9CI) is used as a building block in organic synthesis for the creation of various compounds. Its unique chemical structure allows it to be a versatile component in the synthesis of a wide range of organic molecules.
Used in Pharmaceutical Research:
In the pharmaceutical industry, 5(4H)-Oxazolone,2-(1-aminoethyl)-4-methyl-(9CI) is utilized as a building block for the development of new drugs and bioactive molecules. Its chemical properties make it a promising candidate for the creation of innovative pharmaceutical agents.
Used in Drug Development:
Due to its potential applications in the development of new drugs and bioactive molecules, 5(4H)-Oxazolone,2-(1-aminoethyl)-4-methyl-(9CI) plays a significant role in drug development. Its chemical structure and properties contribute to the advancement of pharmaceutical research and the discovery of novel therapeutic agents.
Check Digit Verification of cas no
The CAS Registry Mumber 791050-65-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 7,9,1,0,5 and 0 respectively; the second part has 2 digits, 6 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 791050-65:
(8*7)+(7*9)+(6*1)+(5*0)+(4*5)+(3*0)+(2*6)+(1*5)=162
162 % 10 = 2
So 791050-65-2 is a valid CAS Registry Number.
InChI:InChI=1/C6H10N2O2/c1-3(7)5-8-4(2)6(9)10-5/h3-4H,7H2,1-2H3
