79997-19-6 Usage
Description
1-(2,5,8,11,14-pentaoxabicyclo[13.4.0]nonadeca-16,18,20-trien-18-yl)-2-phenyl-ethanone is a complex synthetic organic compound characterized by its unique and intricate ring structure. With a molecular formula of C27H28O6, this compound serves as a valuable building block in the pharmaceutical industry for the synthesis of various organic compounds. Its distinctive structural features and properties hold promise for the development of innovative drugs and pharmaceuticals.
Uses
Used in Pharmaceutical Industry:
1-(2,5,8,11,14-pentaoxabicyclo[13.4.0]nonadeca-16,18,20-trien-18-yl)-2-phenyl-ethanone is used as a key intermediate in the synthesis of organic compounds for the pharmaceutical industry. Its unique structure and properties make it a promising candidate for the development of new drugs and pharmaceuticals.
Used in Organic Chemistry Research and Development:
In addition to its pharmaceutical applications, 1-(2,5,8,11,14-pentaoxabicyclo[13.4.0]nonadeca-16,18,20-trien-18-yl)-2-phenyl-ethanone may also be utilized as a reagent in organic chemistry research and development. Its complex ring structure and chemical properties can contribute to the advancement of scientific understanding and the creation of novel chemical processes and products.
Check Digit Verification of cas no
The CAS Registry Mumber 79997-19-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,9,9,9 and 7 respectively; the second part has 2 digits, 1 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 79997-19:
(7*7)+(6*9)+(5*9)+(4*9)+(3*7)+(2*1)+(1*9)=216
216 % 10 = 6
So 79997-19-6 is a valid CAS Registry Number.
InChI:InChI=1/C22H26O6/c23-20(16-18-4-2-1-3-5-18)19-6-7-21-22(17-19)28-15-13-26-11-9-24-8-10-25-12-14-27-21/h1-7,17H,8-16H2