80003-63-0 Usage
Description
2-amino-4-oxo-6-acetyl-7,8-dihydro-3H,9H-pyrimidodiazepine is a member of the class of pyrimidodiazepine 3,7,8,9-tetrahydropyrimido[4,5-b][1,4]diazepin-4-one, characterized by the presence of amino and acetyl substituents at positions 2 and 6, respectively.
Uses
Used in Pharmaceutical Industry:
2-amino-4-oxo-6-acetyl-7,8-dihydro-3H,9H-pyrimidodiazepine is used as a pharmaceutical compound for its potential therapeutic applications. Its unique structure with amino and acetyl groups allows it to interact with various biological targets, making it a promising candidate for the development of new drugs.
Used in Medicinal Chemistry Research:
2-amino-4-oxo-6-acetyl-7,8-dihydro-3H,9H-pyrimidodiazepine serves as a key intermediate in the synthesis of various pyrimidodiazepine-based drug candidates. Its versatile chemical properties enable the design and development of novel therapeutic agents with improved pharmacological profiles.
Used in Drug Discovery:
2-amino-4-oxo-6-acetyl-7,8-dihydro-3H,9H-pyrimidodiazepine is utilized in drug discovery efforts to identify new lead compounds with potential therapeutic benefits. Its unique structural features make it an attractive template for the development of innovative drugs targeting a wide range of diseases and conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 80003-63-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,0,0,0 and 3 respectively; the second part has 2 digits, 6 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 80003-63:
(7*8)+(6*0)+(5*0)+(4*0)+(3*3)+(2*6)+(1*3)=80
80 % 10 = 0
So 80003-63-0 is a valid CAS Registry Number.
InChI:InChI=1/C9H11N5O2/c1-4(15)5-2-3-11-7-6(12-5)8(16)14-9(10)13-7/h2-3H2,1H3,(H4,10,11,13,14,16)
