80018-21-9 Usage
Description
(6E)-4-chloro-6-[(2-chlorophenyl)-(pentadecylamino)methylidene]cyclohe xa-2,4-dien-1-one is a complex organic compound characterized by its cyclohexa-2,4-dien-1-one ring, which features a chloro and methylidene group. The molecule also includes a 2-chlorophenyl group and a pentadecylamino group attached to the cyclohexa-2,4-dien-1-one ring. This unique structure and the presence of various functional groups suggest potential applications in the fields of pharmaceuticals and organic synthesis. However, further investigation, analysis, and testing are necessary to determine its precise properties and uses.
Uses
Used in Pharmaceutical Industry:
(6E)-4-chloro-6-[(2-chlorophenyl)-(pentadecylamino)methylidene]cyclohe xa-2,4-dien-1-one is used as a potential candidate for the development of new drugs due to its complex molecular structure and the presence of various functional groups. Its unique chemical composition may allow for the creation of novel therapeutic agents.
Used in Organic Synthesis:
In the field of organic synthesis, (6E)-4-chloro-6-[(2-chlorophenyl)-(pentadecylamino)methylidene]cyclohe xa-2,4-dien-1-one can be utilized as a starting material or intermediate for the synthesis of other complex organic molecules. Its diverse functional groups may facilitate the development of new synthetic pathways and the production of innovative compounds with various applications.
Check Digit Verification of cas no
The CAS Registry Mumber 80018-21-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,0,0,1 and 8 respectively; the second part has 2 digits, 2 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 80018-21:
(7*8)+(6*0)+(5*0)+(4*1)+(3*8)+(2*2)+(1*1)=89
89 % 10 = 9
So 80018-21-9 is a valid CAS Registry Number.
InChI:InChI=1/C28H39Cl2NO/c1-2-3-4-5-6-7-8-9-10-11-12-13-16-21-31-28(24-17-14-15-18-26(24)30)25-22-23(29)19-20-27(25)32/h14-15,17-20,22,31H,2-13,16,21H2,1H3/b28-25+